Compound Q&A

Is SU 6656 (CAS: 330161-87-0) safe?

Answer

SU 6656
SU 6656 is generally considered safe when used under controlled laboratory conditions. However, it should be handled with caution due to its potential effects on the central nervous system. Proper protective measures, including gloves and goggles, should be employed during handling.

About

English Name SU 6656
Molecular Formula C19H21N3O3S
Molecular Weight 371.45 g/mol
SMILES O=C1Nc2c(C1=Cc1cc3c([nH]1)CCCC3)cc(cc2)S(=O)(=O)N(C)C
InChIKey LOGJQOUIVKBFGH-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is SU 6656 (CAS: 330161-87-0)?

SU 6656 (CAS: 330161-87-0) is a benzodiazepine derivative that acts as a selective 5-HT2A receptor a...

Compound Q&A

What are the main uses of SU 6656 (CAS: 330161-87-0)?

SU 6656 is primarily used in pharmaceutical research to investigate the pharmacological effects of 5...

Compound Q&A

How should SU 6656 (CAS: 330161-87-0) be stored?

SU 6656 should be stored in a tightly sealed, amber glass container to protect it from light. It sho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...