Compound Q&A

What are the main uses of 3-(2,4-Dichlorophenyl)propanoic acid (CAS: 55144-92-8)?

Answer

3-(2,4-Dichlorophenyl)propanoic acid
3-(2,4-Dichlorophenyl)propanoic acid is primarily used in the pharmaceutical industry as an intermediate for the synthesis of other compounds. It is also utilized in research and development for its unique chemical properties. Additionally, it has applications in the synthesis of herbicides and other chemical products.

About

CAS No 55144-92-8
English Name 3-(2,4-Dichlorophenyl)propanoic acid
Molecular Formula C9H8Cl2O2
Molecular Weight 219.07 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)CCC(=O)O
InChIKey HLNPVFSCAMKIOD-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is 3-(2,4-Dichlorophenyl)propanoic acid (CAS: 55144-92-8)?

3-(2,4-Dichlorophenyl)propanoic acid is a chemical compound with the CAS number 55144-92-8. It is an...

Compound Q&A

Is 3-(2,4-Dichlorophenyl)propanoic acid (CAS: 55144-92-8) safe?

3-(2,4-Dichlorophenyl)propanoic acid is generally considered safe when handled with appropriate prec...

Compound Q&A

How should 3-(2,4-Dichlorophenyl)propanoic acid (CAS: 55144-92-8) be stored?

3-(2,4-Dichlorophenyl)propanoic acid should be stored in a cool, dry place at room temperature (15-2...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...