Compound Q&A

What is (3aR,4S,4aR,7aS,8R,9aS)-4a,8-Dimethyl-3-methylene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate (CAS: 54999-07-4)?

Answer

(3aR,4S,4aR,7aS,8R,9aS)-4a,8-Dimethyl-3-methylene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate
This compound is an organosulfur compound with the systematic name (3aR,4S,4aR,7aS,8R,9aS)-4a,8-Dimethyl-3-methylene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate. It features a complex structure with methyl groups and a methylene bridge. This compound is known for its stability and unique chemical properties.

About

CAS No 54999-07-4
English Name (3aR,4S,4aR,7aS,8R,9aS)-4a,8-Dimethyl-3-methylene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate
Molecular Formula C17H22O5
Molecular Weight 306.36 g/mol
SMILES C[C@@H]1C[C@@H]2OC(=O)C(=C)[C@H]2[C@H](OC(C)=O)[C@@]2(C)[C@H]1CCC2=O
InChIKey JCDZXDWMCKMXFF-MMLVVLEOSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What are the main uses of (3aR,4S,4aR,7aS,8R,9aS)-4a,8-Dimethyl-3-methylene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate (CAS: 54999-07-4)?

This compound is primarily used in research and development for its unique chemical properties. It i...

Compound Q&A

Is (3aR,4S,4aR,7aS,8R,9aS)-4a,8-Dimethyl-3-methylene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate (CAS: 54999-07-4) safe?

This compound is generally considered safe when handled with appropriate precautions. Users should f...

Compound Q&A

How should (3aR,4S,4aR,7aS,8R,9aS)-4a,8-Dimethyl-3-methylene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate (CAS: 54999-07-4) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. Keep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...