Compound Q&A

What are the main uses of (5-Nitro-1H-benzimidazol-2-yl)methanol (CAS: 20034-00-8)?

Answer

(5-Nitro-1H-benzimidazol-2-yl)methanol
(5-Nitro-1H-benzimidazol-2-yl)methanol (CAS: 20034-00-8) is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It plays a crucial role in the development of anti-inflammatory and analgesic drugs. Additionally, it is used in the preparation of dyes and pigments.

About

CAS No 20034-00-8
English Name (5-Nitro-1H-benzimidazol-2-yl)methanol
Molecular Formula C8H7N3O3
Molecular Weight 193.16 g/mol
SMILES C1=CC2=C(C=C1[N+](=O)[O-])NC(=N2)CO
InChIKey ZJLPIDVKNQXTKN-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is (5-Nitro-1H-benzimidazol-2-yl)methanol (CAS: 20034-00-8)?

(5-Nitro-1H-benzimidazol-2-yl)methanol (CAS: 20034-00-8) is a chemical compound with the molecular f...

Compound Q&A

Is (5-Nitro-1H-benzimidazol-2-yl)methanol (CAS: 20034-00-8) safe?

(5-Nitro-1H-benzimidazol-2-yl)methanol (CAS: 20034-00-8) is generally considered safe for laboratory...

Compound Q&A

How should (5-Nitro-1H-benzimidazol-2-yl)methanol (CAS: 20034-00-8) be stored?

(5-Nitro-1H-benzimidazol-2-yl)methanol (CAS: 20034-00-8) should be stored in a cool, dry place away ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...