Compound Q&A

What are the main uses of (4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid (CAS: 3813-05-6)?

Answer

(4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid
(4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in chemical research and as a reagent in organic synthesis.

About

CAS No 3813-05-6
English Name (4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid
Molecular Formula C9H6ClNO3S
Molecular Weight 243.67 g/mol
SMILES C1=CC2=C(C(=C1)Cl)N(C(=O)S2)CC(=O)O
InChIKey HYJSGOXICXYZGS-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is (4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid (CAS: 3813-05-6)?

(4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid is a chemical compound with the CAS number 381...

Compound Q&A

Is (4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid (CAS: 3813-05-6) safe?

(4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid is generally safe when handled with proper pre...

Compound Q&A

How should (4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid (CAS: 3813-05-6) be stored?

(4-Chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid should be stored in a cool, dry place away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...