Compound Q&A

What is 1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone (CAS: 12217-79-7)?

Answer

1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone
1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone is a chemical compound with a distinctive molecular structure. It comprises a chlorinated and hydroxylated anthraquinone core with two amino groups. This compound is characterized by its aromatic nature and specific functional groups, which contribute to its reactivity and potential applications in various fields.

About

CAS No 12217-79-7
English Name 1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone
Molecular Formula C14H9ClN2O4
Molecular Weight 304.69 g/mol
SMILES c1cc(c2c(c1N)C(=O)c3c(cc(c(c3C2=O)N)Cl)O)O
InChIKey SIRMWLMEYFPGAD-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What are the main uses of 1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone (CAS: 12217-79-7)?

1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone is primarily used in pharmaceuticals for its a...

Compound Q&A

Is 1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone (CAS: 12217-79-7) safe?

1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone, while useful in various applications, require...

Compound Q&A

How should 1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone (CAS: 12217-79-7) be stored?

1,5-Diamino-2-chloro-4,8-dihydroxy-9,10-anthraquinone should be stored in a cool, dry place, away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...