Compound Q&A

What is benzenesulfonylsulfanylsulfonylbenzene (CAS: 4388-22-1)?

Answer

benzenesulfonylsulfanylsulfonylbenzene
Benzenesulfonylsulfanylsulfonylbenzene (CAS: 4388-22-1) is a complex aromatic compound characterized by its molecular structure, which includes benzene rings and sulfonyl and sulfanyl functional groups. This compound is stable under normal conditions but exhibits unique reactivity due to its functional groups.

About

CAS No 4388-22-1
English Name benzenesulfonylsulfanylsulfonylbenzene
Molecular Formula C12H10O4S3
Molecular Weight 314.41 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)SS(=O)(=O)C2=CC=CC=C2
InChIKey YQUSJUJNDKUWAM-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What are the main uses of benzenesulfonylsulfanylsulfonylbenzene (CAS: 4388-22-1)?

Benzenesulfonylsulfanylsulfonylbenzene (CAS: 4388-22-1) is primarily used in pharmaceuticals, as a p...

Compound Q&A

Is benzenesulfonylsulfanylsulfonylbenzene (CAS: 4388-22-1) safe?

Benzenesulfonylsulfanylsulfonylbenzene (CAS: 4388-22-1) is generally considered safe if handled with...

Compound Q&A

How should benzenesulfonylsulfanylsulfonylbenzene (CAS: 4388-22-1) be stored?

Benzenesulfonylsulfanylsulfonylbenzene (CAS: 4388-22-1) should be stored in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...