Compound Q&A

What is the market or research trend for (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (CAS: 856645-99-3)?

Answer

(1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (1:1)
The market for (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (CAS: 856645-99-3) is expanding due to its applications in medicinal chemistry and pharmaceuticals. Research trends are focusing on its potential as a lead compound in drug development for treating various diseases, including neurodegenerative disorders. The compound's unique chemical structure makes it a promising candidate for further investigation in novel drug discovery.

About

English Name (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (1:1)
Molecular Formula C9H11ClF3N
Molecular Weight 225.64 g/mol
SMILES Cl.C[C@@H](N)c1ccc(cc1)C(F)(F)F
InChIKey JVLWNYKROJNLAS-FYZOBXCZSA-N
Last Updated: 2025-10-27 07:45

Related Q&A

Compound Q&A

What regulatory guidelines apply to (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (CAS: 856645-99-3)?

The compound (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (CAS: 856645-99-3) is regula...

Compound Q&A

Are there alternatives to (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (CAS: 856645-99-3) in synthesis?

Several alternatives can be used in the synthesis of (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hy...

Compound Q&A

How should waste containing (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (CAS: 856645-99-3) be handled?

Waste containing (1R)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride (CAS: 856645-99-3) shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...