Compound Q&A

Are there alternatives to a-D-Glucosamine Pentaacetate (CAS: 7784-54-5) in synthesis?

Answer

a-D-Glucosamine Pentaacetate
While a-D-Glucosamine Pentaacetate (CAS: 7784-54-5) is a commonly used reagent, there are alternatives available. For example, other acetylated glucosamine derivatives or different sugar derivatives might be used depending on the specific synthesis requirements. Additionally, exploring other synthetic routes or using different functional groups can provide alternatives to a-D-Glucosamine Pentaacetate in various chemical processes.

About

CAS No 7784-54-5
English Name a-D-Glucosamine Pentaacetate
Molecular Formula C16H23NO10
Molecular Weight 389.36 g/mol
SMILES CC(=O)NC1C(C(C(OC1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C
InChIKey OVPIZHVSWNOZMN-QCODTGAPSA-N
Last Updated: 2025-10-27 07:45

Related Q&A

Compound Q&A

What regulatory guidelines apply to a-D-Glucosamine Pentaacetate (CAS: 7784-54-5)?

a-D-Glucosamine Pentaacetate (CAS: 7784-54-5) is subject to various regulatory guidelines. In the Un...

Compound Q&A

What is the market or research trend for a-D-Glucosamine Pentaacetate (CAS: 7784-54-5)?

a-D-Glucosamine Pentaacetate (CAS: 7784-54-5) is in demand for its use in pharmaceuticals and organi...

Compound Q&A

How should waste containing a-D-Glucosamine Pentaacetate (CAS: 7784-54-5) be handled?

Waste containing a-D-Glucosamine Pentaacetate (CAS: 7784-54-5) should be handled according to local ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...