Compound Q&A

Are there alternatives to Methyl 4-bromo-2-nitrobenzoate (CAS: 158580-57-5) in synthesis?

Answer

Methyl 4-bromo-2-nitrobenzoate
There are several alternatives to Methyl 4-bromo-2-nitrobenzoate in synthesis, including other nitrobenzoic acid derivatives such as Methyl 3-bromo-2-nitrobenzoate or Methyl 4-nitro-2-chlorobenzoate. These can be used depending on the specific reaction conditions and desired product. Additionally, synthetic analogs such as Methyl 4-bromo-3-nitrobenzoate can be considered as alternatives.

About

English Name Methyl 4-bromo-2-nitrobenzoate
Molecular Formula C8H6BrNO4
Molecular Weight 260.04 g/mol
SMILES COC(=O)c1ccc(cc1[N+](=O)[O-])Br
InChIKey YTWDMAAPIWOIFZ-UHFFFAOYSA-N
Last Updated: 2025-10-27 07:45

Related Q&A

Compound Q&A

What regulatory guidelines apply to Methyl 4-bromo-2-nitrobenzoate (CAS: 158580-57-5)?

Methyl 4-bromo-2-nitrobenzoate (CAS: 158580-57-5) falls under the regulatory guidelines set by the G...

Compound Q&A

What is the market or research trend for Methyl 4-bromo-2-nitrobenzoate (CAS: 158580-57-5)?

The market for Methyl 4-bromo-2-nitrobenzoate is driven by its use in research and development, part...

Compound Q&A

How should waste containing Methyl 4-bromo-2-nitrobenzoate (CAS: 158580-57-5) be handled?

Waste containing Methyl 4-bromo-2-nitrobenzoate should be collected and stored in a sealed container...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...