Compound Q&A

What is the market or research trend for Methyl 5-amino-2-bromobenzoate (CAS: 6942-37-6)?

Answer

Methyl 5-amino-2-bromobenzoate
The market for Methyl 5-amino-2-bromobenzoate (CAS: 6942-37-6) is driven by its potential applications in pharmaceuticals and agrochemicals. Recent research trends indicate a growing interest in this compound due to its unique chemical properties and its ability to serve as a building block for complex molecules. Market dynamics show increasing demand from industries that require specialized intermediates for drug development and crop protection. However, the availability and cost of the compound can fluctuate based on supply and demand factors.

About

CAS No 6942-37-6
English Name Methyl 5-amino-2-bromobenzoate
Molecular Formula C8H8BrNO2
Molecular Weight 230.061 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)N)Br
InChIKey OFDWPQOLEQDJIX-UHFFFAOYSA-N
Last Updated: 2025-10-27 07:45

Related Q&A

Compound Q&A

What regulatory guidelines apply to Methyl 5-amino-2-bromobenzoate (CAS: 6942-37-6)?

Methyl 5-amino-2-bromobenzoate (CAS: 6942-37-6) falls under the jurisdiction of various regulatory a...

Compound Q&A

Are there alternatives to Methyl 5-amino-2-bromobenzoate (CAS: 6942-37-6) in synthesis?

When considering alternatives to Methyl 5-amino-2-bromobenzoate (CAS: 6942-37-6), chemists might exp...

Compound Q&A

How should waste containing Methyl 5-amino-2-bromobenzoate (CAS: 6942-37-6) be handled?

Waste containing Methyl 5-amino-2-bromobenzoate (CAS: 6942-37-6) should be handled with care to ensu...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...