Compound Q&A

Are there alternatives to 3-Amino-6-chloro-2-pyrazinecarboxylic acid (CAS: 2727-13-1) in synthesis?

Answer

3-Amino-6-chloro-2-pyrazinecarboxylic acid
While 3-Amino-6-chloro-2-pyrazinecarboxylic acid (CAS: 2727-13-1) is a specific compound, there are alternative reagents that can be used in similar syntheses. Analog compounds, such as 3-amino-2-pyrazinecarboxylic acid or 6-chloro-3-pyrazinecarboxylic acid, can serve as viable substitutes. The choice of alternative depends on the desired properties and the specific reaction conditions.

About

CAS No 2727-13-1
English Name 3-Amino-6-chloro-2-pyrazinecarboxylic acid
Molecular Formula C5H4ClN3O2
Molecular Weight 173.56 g/mol
SMILES C1=C(N=C(C(=N1)N)C(=O)O)Cl
InChIKey TZEPSUWOCPVNMM-UHFFFAOYSA-N
Last Updated: 2025-10-26 15:06

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3-Amino-6-chloro-2-pyrazinecarboxylic acid (CAS: 2727-13-1)?

3-Amino-6-chloro-2-pyrazinecarboxylic acid (CAS: 2727-13-1) is subject to GHS classification for hea...

Compound Q&A

What is the market or research trend for 3-Amino-6-chloro-2-pyrazinecarboxylic acid (CAS: 2727-13-1)?

The market trend for 3-Amino-6-chloro-2-pyrazinecarboxylic acid (CAS: 2727-13-1) reflects increasing...

Compound Q&A

How should waste containing 3-Amino-6-chloro-2-pyrazinecarboxylic acid (CAS: 2727-13-1) be handled?

Waste containing 3-Amino-6-chloro-2-pyrazinecarboxylic acid (CAS: 2727-13-1) should be collected and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...