Compound Q&A

What precautions should be taken when handling Dihydro-FK506 (CAS: 104987-30-6)?

Answer

Dihydro-FK506
When handling Dihydro-FK506 (CAS: 104987-30-6), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood due to its potential to irritate the respiratory system. In case of a spill, immediately clean it up using appropriate absorbents and follow the safety data sheet (SDS) for further guidance. Ensure proper storage in a cool, dry place away from direct sunlight and incompatible materials.

About

English Name Dihydro-FK506
Molecular Formula C44H71NO12
Molecular Weight 806.05 g/mol
SMILES CCCC1C=C(CC(CC(C2C(CC(C(O2)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C(CC1=O)O)C)C(=CC4CCC(C(C4)OC)O)C)O)C)OC)OC)C)C
InChIKey RQYGKZGKXDOUEO-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dihydro-FK506 (CAS: 104987-30-6)?

Dihydro-FK506 is a crystalline compound (CAS: 104987-30-6) with a molecular weight of approximately ...

Compound Q&A

How is Dihydro-FK506 (CAS: 104987-30-6) typically synthesized?

Dihydro-FK506 (CAS: 104987-30-6) is typically synthesized through a multistep process involving key ...

Compound Q&A

What industries use Dihydro-FK506 (CAS: 104987-30-6)?

Dihydro-FK506 (CAS: 104987-30-6) is primarily used in the pharmaceutical industry for its immunosupp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...