Compound Q&A

What are the physical and chemical properties of 4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol (CAS: 1139-52-2)?

Answer

4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol
4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol (CAS: 1139-52-2) is a crystalline solid with a molecular weight of approximately 356.01 g/mol. It has a low water solubility, with a solubility of about 0.01 g/L. Chemically, it is relatively unreactive, showing limited reactivity towards common nucleophiles and electrophiles. It has a melting point of around 55-57°C and a boiling point of approximately 232-234°C. This compound is often used in organic synthesis and pharmaceutical applications.

About

CAS No 1139-52-2
English Name 4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol
Molecular Formula C14H21BrO
Molecular Weight 285.22 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)Br
InChIKey SSQQUEKFNSJLKX-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is 4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol (CAS: 1139-52-2) typically synthesized?

4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol is typically synthesized via a multi-step process. It inv...

Compound Q&A

What industries use 4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol (CAS: 1139-52-2)?

4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol (CAS: 1139-52-2) is utilized in various industries, parti...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol (CAS: 1139-52-2)?

When handling 4-Bromo-2,6-bis(2-methyl-2-propanyl)phenol (CAS: 1139-52-2), it is essential to follow...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...