Compound Q&A

How is 2-(1-Pyrrolidinyl)benzoic acid (CAS: 78648-27-8) typically synthesized?

Answer

2-(1-Pyrrolidinyl)benzoic acid
2-(1-Pyrrolidinyl)benzoic acid is typically synthesized by reacting pyrrolidine with benzoic anhydride. The reaction involves the formation of an ester, followed by hydrolysis with an acid or base to yield the final product. The reaction is selective and provides a high yield, making it a common method for industrial production.

About

CAS No 78648-27-8
English Name 2-(1-Pyrrolidinyl)benzoic acid
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES C1CCN(C1)C2=CC=CC=C2C(=O)O
InChIKey SSALRORMOVCZTK-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(1-Pyrrolidinyl)benzoic acid (CAS: 78648-27-8)?

2-(1-Pyrrolidinyl)benzoic acid (CAS: 78648-27-8) is a white crystalline solid with a molecular weigh...

Compound Q&A

What industries use 2-(1-Pyrrolidinyl)benzoic acid (CAS: 78648-27-8)?

2-(1-Pyrrolidinyl)benzoic acid (CAS: 78648-27-8) is used in the pharmaceutical industry for synthesi...

Compound Q&A

What precautions should be taken when handling 2-(1-Pyrrolidinyl)benzoic acid (CAS: 78648-27-8)?

When handling 2-(1-Pyrrolidinyl)benzoic acid (CAS: 78648-27-8), it is important to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...