Compound Q&A

What are the physical and chemical properties of Ethyl D-Glucuronide (CAS: 17685-04-0)?

Answer

Ethyl D-Glucuronide
Ethyl D-Glucuronide (CAS: 17685-04-0) is a crystalline compound with a molecular weight of approximately 278.23 g/mol. It has a low solubility in water but is moderately soluble in organic solvents. It is relatively stable under normal conditions but can undergo hydrolysis in the presence of acid or base. Ethyl D-Glucuronide is used in various applications due to its unique chemical properties.

About

CAS No 17685-04-0
English Name Ethyl D-Glucuronide
Molecular Formula C8H14O7
Molecular Weight 222.19 g/mol
SMILES CCO[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O)O)O
InChIKey IWJBVMJWSPZNJH-UQGZVRACSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is Ethyl D-Glucuronide (CAS: 17685-04-0) typically synthesized?

Ethyl D-Glucuronide (CAS: 17685-04-0) is typically synthesized through the nucleophilic substitution...

Compound Q&A

What industries use Ethyl D-Glucuronide (CAS: 17685-04-0)?

Ethyl D-Glucuronide (CAS: 17685-04-0) is primarily used in pharmaceuticals for the detection of drug...

Compound Q&A

What precautions should be taken when handling Ethyl D-Glucuronide (CAS: 17685-04-0)?

When handling Ethyl D-Glucuronide (CAS: 17685-04-0), it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...