Compound Q&A

What are the physical and chemical properties of (5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one (CAS: 1937-54-8)?

Answer

(5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one
(5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one is a colorless liquid with a molecular weight of approximately 158.25 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. The compound is known for its reactivity, particularly towards nucleophiles and electrophiles, and exhibits a high degree of stability under normal conditions.

About

CAS No 1937-54-8
English Name (5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one
Molecular Formula C13H22O
Molecular Weight 194.32 g/mol
SMILES CC(C)C(CCC(=O)C)C=CC(=C)C
InChIKey PQDRXUSSKFWCFA-CFNZNRNTSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is (5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one (CAS: 1937-54-8) typically synthesized?

(5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one is usually synthesized via a Wittig reaction startin...

Compound Q&A

What industries use (5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one (CAS: 1937-54-8)?

(5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one is utilized in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling (5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one (CAS: 1937-54-8)?

When handling (5S,6E)-5-Isopropyl-8-methyl-6,8-nonadien-2-one, it is important to wear personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...