Compound Q&A

What industries use 2-Amino-4-(2-methyl-2-propanyl)benzoic acid (CAS: 728945-64-0)?

Answer

2-Amino-4-(2-methyl-2-propanyl)benzoic acid
2-Amino-4-(2-methyl-2-propanyl)benzoic acid is used in various industries. It finds applications in the pharmaceutical sector for the preparation of certain drugs. It is also utilized in the polymer industry as a monomer for the synthesis of functional polymers. Additionally, it has applications in the semiconductor industry as a dopant for electronic materials and in sensors for its reactivity.

About

English Name 2-Amino-4-(2-methyl-2-propanyl)benzoic acid
Molecular Formula C11H15NO2
Molecular Weight 193.24599999999998 g/mol
SMILES CC(C)(C)C1=CC(=C(C=C1)C(=O)O)N
InChIKey XLIGRZYQIUYNDR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-4-(2-methyl-2-propanyl)benzoic acid (CAS: 728945-64-0)?

2-Amino-4-(2-methyl-2-propanyl)benzoic acid is a solid with a crystalline form. It has a molecular w...

Compound Q&A

How is 2-Amino-4-(2-methyl-2-propanyl)benzoic acid (CAS: 728945-64-0) typically synthesized?

2-Amino-4-(2-methyl-2-propanyl)benzoic acid can be synthesized through a multi-step process. A commo...

Compound Q&A

What precautions should be taken when handling 2-Amino-4-(2-methyl-2-propanyl)benzoic acid (CAS: 728945-64-0)?

When handling 2-Amino-4-(2-methyl-2-propanyl)benzoic acid, appropriate personal protective equipment...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...