Compound Q&A

How is 2-Amino-4-(2-methyl-2-propanyl)benzoic acid (CAS: 728945-64-0) typically synthesized?

Answer

2-Amino-4-(2-methyl-2-propanyl)benzoic acid
2-Amino-4-(2-methyl-2-propanyl)benzoic acid can be synthesized through a multi-step process. A common method involves the reaction of 2-methyl-2-propanol with benzoic anhydride followed by the addition of excess ammonia to form the amino derivative. The reaction is typically conducted under basic conditions, and the product is isolated by crystallization. Catalysts like sodium hydroxide may be used to enhance reactivity and selectivity.

About

English Name 2-Amino-4-(2-methyl-2-propanyl)benzoic acid
Molecular Formula C11H15NO2
Molecular Weight 193.24599999999998 g/mol
SMILES CC(C)(C)C1=CC(=C(C=C1)C(=O)O)N
InChIKey XLIGRZYQIUYNDR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-4-(2-methyl-2-propanyl)benzoic acid (CAS: 728945-64-0)?

2-Amino-4-(2-methyl-2-propanyl)benzoic acid is a solid with a crystalline form. It has a molecular w...

Compound Q&A

What industries use 2-Amino-4-(2-methyl-2-propanyl)benzoic acid (CAS: 728945-64-0)?

2-Amino-4-(2-methyl-2-propanyl)benzoic acid is used in various industries. It finds applications in ...

Compound Q&A

What precautions should be taken when handling 2-Amino-4-(2-methyl-2-propanyl)benzoic acid (CAS: 728945-64-0)?

When handling 2-Amino-4-(2-methyl-2-propanyl)benzoic acid, appropriate personal protective equipment...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...