Compound Q&A

What precautions should be taken when handling Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS: 923009-50-1)?

Answer

Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate
When handling Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS: 923009-50-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Work should be performed in a well-ventilated area or a fume hood. In case of a spill, clean it up using appropriate absorbent materials and dispose of according to local regulations. Always refer to the safety data sheet (SDS) for detailed handling and safety information.

About

English Name Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate
Molecular Formula C13H22N2O3
Molecular Weight 254.33 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC2(C1)CCNC2=O
InChIKey QCRYPCJMEOXBJL-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS: 923009-50-1)?

Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS: 923009-50-1) has a crystalline form w...

Compound Q&A

How is Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS: 923009-50-1) typically synthesized?

Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS: 923009-50-1) is typically synthesized...

Compound Q&A

What industries use Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS: 923009-50-1)?

Tert-butyl 1-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate (CAS: 923009-50-1) is primarily used in the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...