Compound Q&A

What are the physical and chemical properties of Diethylene glycol phthalic anhydride polymer (CAS: 32472-85-8)?

Answer

Diethylene glycol phthalic anhydride polymer
Diethylene glycol phthalic anhydride polymer has a crystalline form with a molecular weight around 300-400 g/mol. It is moderately soluble in common organic solvents like acetone and dimethylformamide. The polymer is known for its high reactivity, particularly in esterification reactions, and its thermal stability up to 250°C.

About

CAS No 32472-85-8
English Name Diethylene glycol phthalic anhydride polymer
Molecular Formula (C8H4O3.C4H10O3)n
Molecular Weight 254.24 g/mol
SMILES OCCOCCO.O=C1C2C(=CC=CC=2)C(=O)O1
InChIKey ZLBFMYQIKPWYBC-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is Diethylene glycol phthalic anhydride polymer (CAS: 32472-85-8) typically synthesized?

Diethylene glycol phthalic anhydride polymer is synthesized by the condensation of diethylene glycol...

Compound Q&A

What industries use Diethylene glycol phthalic anhydride polymer (CAS: 32472-85-8)?

Diethylene glycol phthalic anhydride polymer is widely used in the polymer industry for the producti...

Compound Q&A

What precautions should be taken when handling Diethylene glycol phthalic anhydride polymer (CAS: 32472-85-8)?

When handling Diethylene glycol phthalic anhydride polymer, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...