Compound Q&A

What are the physical and chemical properties of 2-Amino-4(1H)-quinolinone (CAS: 42712-64-1)?

Answer

2-Amino-4(1H)-quinolinone
2-Amino-4(1H)-quinolinone (CAS: 42712-64-1) is a white or off-white crystalline solid with a molecular weight of approximately 207.21 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. This compound is known for its basic properties and can react with acids to form salts. It is relatively stable under normal conditions but may undergo hydrolysis in strong acidic media.

About

CAS No 42712-64-1
English Name 2-Amino-4(1H)-quinolinone
Molecular Formula C9H8N2O
Molecular Weight 160.18 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C=C(N2)N
InChIKey LWGUCIXHBVVATR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is 2-Amino-4(1H)-quinolinone (CAS: 42712-64-1) typically synthesized?

2-Amino-4(1H)-quinolinone (CAS: 42712-64-1) is commonly synthesized via the oxidation of 2-aminoquin...

Compound Q&A

What industries use 2-Amino-4(1H)-quinolinone (CAS: 42712-64-1)?

2-Amino-4(1H)-quinolinone (CAS: 42712-64-1) finds applications in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-Amino-4(1H)-quinolinone (CAS: 42712-64-1)?

When handling 2-Amino-4(1H)-quinolinone (CAS: 42712-64-1), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...