Compound Q&A

What are the physical and chemical properties of 9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one (CAS: 1438383-89-1)?

Answer

9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one
9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one is a solid, crystalline compound with a molecular weight of approximately 496.32 g/mol. It is poorly soluble in water but soluble in organic solvents like dichloromethane and ethyl acetate. The compound is relatively stable but can react with nucleophiles due to its bromo and bromoacetyl groups. It has low reactivity in neutral and basic media but can undergo substitution reactions in acidic conditions.

About

English Name 9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one
Molecular Formula C19H14Br2O3
Molecular Weight 450.13 g/mol
SMILES c1cc-2c(cc1C(=O)CBr)COc3c2cc4c(c3)C(=O)C(CC4)Br
InChIKey NVSLOKHCHIFJDR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is 9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one (CAS: 1438383-89-1) typically synthesized?

9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one can be synthesized through a ...

Compound Q&A

What industries use 9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one (CAS: 1438383-89-1)?

9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one (CAS: 1438383-89-1)?

Handling 9-Bromo-3-(bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one requires careful att...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...