Compound Q&A

How is Glucose isomerase from Streptomyces rubiginosus (CAS: 9055-00-9) typically synthesized?

Answer

Glucose isomerase from streptomyces rubiginosus
Glucose isomerase from Streptomyces rubiginosus (CAS: 9055-00-9) is typically synthesized through fermentation using the bacterium Streptomyces rubiginosus. The process involves culturing the microorganism in a suitable medium, followed by extraction, purification, and crystallization steps. Commonly used media include glucose and peptone, and the fermentation is usually conducted at 30-35°C with a pH of 6.5-7.0.

About

CAS No 9055-00-9
English Name Glucose isomerase from streptomyces rubiginosus
Molecular Formula C17H17ClN2O3S
Molecular Weight 364.85 g/mol
SMILES C1CN(CCN1C(=O)C2=CC=CC=C2Cl)S(=O)(=O)C3=CC=CC=C3
InChIKey WNQJZQMIEZWFIN-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Glucose isomerase from Streptomyces rubiginosus (CAS: 9055-00-9)?

Glucose isomerase from Streptomyces rubiginosus (CAS: 9055-00-9) is a crystalline protein with a mol...

Compound Q&A

What industries use Glucose isomerase from Streptomyces rubiginosus (CAS: 9055-00-9)?

Glucose isomerase from Streptomyces rubiginosus (CAS: 9055-00-9) is widely used in the food and beve...

Compound Q&A

What precautions should be taken when handling Glucose isomerase from Streptomyces rubiginosus (CAS: 9055-00-9)?

When handling Glucose isomerase from Streptomyces rubiginosus (CAS: 9055-00-9), safety precautions s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...