Compound Q&A

How is Benzene-1,3,5-triyltriboronic acid (CAS: 89641-21-4) typically synthesized?

Answer

Benzene-1,3,5-triyltriboronic acid
Benzene-1,3,5-triyltriboronic acid is typically synthesized by the reaction of boronic acids with 1,3,5-benzenetricarboxylic acid in the presence of a catalytic amount of a base. The reaction is known for its high yield and selectivity, making it a reliable method for preparing this compound.

About

CAS No 89641-21-4
English Name Benzene-1,3,5-triyltriboronic acid
Molecular Formula C6H9B3O6
Molecular Weight 209.57 g/mol
SMILES B(C1=CC(=CC(=C1)B(O)O)B(O)O)(O)O
InChIKey NAIUYXOLMQYLIG-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzene-1,3,5-triyltriboronic acid (CAS: 89641-21-4)?

Benzene-1,3,5-triyltriboronic acid is a colorless or white crystalline solid at room temperature. It...

Compound Q&A

What industries use Benzene-1,3,5-triyltriboronic acid (CAS: 89641-21-4)?

Benzene-1,3,5-triyltriboronic acid is used in various industries, including pharmaceuticals for the ...

Compound Q&A

What precautions should be taken when handling Benzene-1,3,5-triyltriboronic acid (CAS: 89641-21-4)?

When handling Benzene-1,3,5-triyltriboronic acid, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...