Compound Q&A

How is PX-478 (CAS: 685898-44-6) typically synthesized?

Answer

PX-478
PX-478 is synthesized via a multi-step reaction involving the condensation of a cyclic ketone with an aromatic amine, followed by hydrogenation. The synthesis typically requires the use of a palladium catalyst and occurs under normal temperature and pressure conditions, with high selectivity and good yield.

About

English Name PX-478
Molecular Formula C13H20Cl4N2O3
Molecular Weight 394.12 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)[N+](CCCl)(CCCl)[O-].Cl.Cl
InChIKey GIGCDIVNDFQKRA-LTCKWSDVSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of PX-478 (CAS: 685898-44-6)?

PX-478 is a crystalline compound with a molecular weight of approximately 228.23 g/mol. It has a low...

Compound Q&A

What industries use PX-478 (CAS: 685898-44-6)?

PX-478 finds applications in the pharmaceutical industry for drug synthesis, particularly in the dev...

Compound Q&A

What precautions should be taken when handling PX-478 (CAS: 685898-44-6)?

When handling PX-478, it is crucial to wear appropriate personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...