Compound Q&A

How is N-(3-Chlorophenyl)-2-pyridinecarboxamide (CAS: 61350-00-3) typically synthesized?

Answer

N-(3-Chlorophenyl)-2-pyridinecarboxamide
N-(3-Chlorophenyl)-2-pyridinecarboxamide can be synthesized through the coupling reaction of 3-chlorophenyl isocyanate with 2-pyridinecarboxamide. The synthesis typically involves heating the reactants in the presence of a catalyst such as 4-(dimethylamino)pyridine (DMAP) and a base like diisopropylethylamine (DIPEA). The yield is usually around 75-85%, and the reaction is selective and efficient.

About

CAS No 61350-00-3
English Name N-(3-Chlorophenyl)-2-pyridinecarboxamide
Molecular Formula C12H9ClN2O
Molecular Weight 232.67000000000002 g/mol
SMILES C1=CC=NC(=C1)C(=O)NC2=CC(=CC=C2)Cl
InChIKey SUYUTNCKIOLMAJ-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(3-Chlorophenyl)-2-pyridinecarboxamide (CAS: 61350-00-3)?

N-(3-Chlorophenyl)-2-pyridinecarboxamide is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use N-(3-Chlorophenyl)-2-pyridinecarboxamide (CAS: 61350-00-3)?

N-(3-Chlorophenyl)-2-pyridinecarboxamide is primarily used in the pharmaceutical and chemical indust...

Compound Q&A

What precautions should be taken when handling N-(3-Chlorophenyl)-2-pyridinecarboxamide (CAS: 61350-00-3)?

When handling N-(3-Chlorophenyl)-2-pyridinecarboxamide, it is important to use personal protective e...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...