Compound Q&A

What are the physical and chemical properties of 1,2,3,4,5-Cyclopentanepentayl, compd. with 1-[bis(4-methoxy-3,5-dimethylphenyl)phosphino]-2-[(1R)-1-(dicyclohexylphosphino)ethyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1) (CAS: 360048-63-1)?

Answer

1,2,3,4,5-Cyclopentanepentayl, compd. with 1-[bis(4-methoxy-3,5-dimethylphenyl)phosphino]-2-[(1R)-1-(dicyclohexylphosphino)ethyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
The compound exhibits a crystalline form with a high melting point. Its molecular weight is approximately 1250 g/mol. It has low solubility in water but is soluble in organic solvents. It is relatively stable but can react with acids and bases under certain conditions. The iron salt forms a complex with the cyclopentane core, enhancing its reactivity in coordination chemistry applications.

About

English Name 1,2,3,4,5-Cyclopentanepentayl, compd. with 1-[bis(4-methoxy-3,5-dimethylphenyl)phosphino]-2-[(1R)-1-(dicyclohexylphosphino)ethyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
Molecular Formula C42H56FeO2P2
Molecular Weight 710.7 g/mol
SMILES Cc1cc(cc(c1OC)C)P(c2cc(c(c(c2)C)OC)C)[C]3[CH][CH][CH][C]3[C@@H](C)P(C4CCCCC4)C5CCCCC5.[CH]1[CH][CH][CH][CH]1.[Fe]
InChIKey KBTRXGJMLCCSLF-AWIKAUGJSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...