Compound Q&A

What are the main uses of Hexakis(4-bromophenyl)benzene (CAS: 19057-50-2)?

Answer

Hexakis(4-bromophenyl)benzene
Hexakis(4-bromophenyl)benzene (CAS: 19057-50-2) is predominantly used in research for the synthesis of other compounds, particularly in the development of new materials and pharmaceuticals. It serves as a key intermediate in organic synthesis.

About

CAS No 19057-50-2
English Name Hexakis(4-bromophenyl)benzene
Molecular Formula C42H24Br6
Molecular Weight 1008.08 g/mol
SMILES C1=CC(=CC=C1C2=C(C(=C(C(=C2C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br)C5=CC=C(C=C5)Br)C6=CC=C(C=C6)Br)C7=CC=C(C=C7)Br)Br
InChIKey KUSYGQSHKDPKRR-UHFFFAOYSA-N
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What is Hexakis(4-bromophenyl)benzene (CAS: 19057-50-2)?

Hexakis(4-bromophenyl)benzene (CAS: 19057-50-2) is an organic compound consisting of a central benze...

Compound Q&A

Is Hexakis(4-bromophenyl)benzene (CAS: 19057-50-2) safe?

Hexakis(4-bromophenyl)benzene (CAS: 19057-50-2) is generally considered unsafe due to its reactivity...

Compound Q&A

How should Hexakis(4-bromophenyl)benzene (CAS: 19057-50-2) be stored?

Hexakis(4-bromophenyl)benzene (CAS: 19057-50-2) should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...