Compound Q&A

How should (2E,4E)-2,4-hexadienoic acid sodium salt (CAS: 7757-81-5) be stored?

Answer

Sodium (2E,4E)-2,4-hexadienoate
(2E,4E)-2,4-Hexadienoic acid sodium salt (CAS: 7757-81-5) should be stored in a tightly sealed container in a cool, dry place away from direct sunlight and sources of heat. Maintain a temperature between 15°C and 25°C (59°F and 77°F) and avoid exposure to moisture and humidity to prevent degradation of the compound.

About

CAS No 7757-81-5
English Name Sodium (2E,4E)-2,4-hexadienoate
Molecular Formula C6H7NaO2
Molecular Weight 134.11 g/mol
SMILES C/C=C/C=C/C(=O)[O-].[Na+]
InChIKey LROWVYNUWKVTCU-STWYSWDKSA-M
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What is (2E,4E)-2,4-hexadienoic acid sodium salt (CAS: 7757-81-5)?

(2E,4E)-2,4-Hexadienoic acid sodium salt, also known as sodium (2E,4E)-2,4-hexadienoate, is a chemic...

Compound Q&A

What are the main uses of (2E,4E)-2,4-hexadienoic acid sodium salt (CAS: 7757-81-5)?

(2E,4E)-2,4-Hexadienoic acid sodium salt (CAS: 7757-81-5) is primarily used in the pharmaceutical in...

Compound Q&A

Is (2E,4E)-2,4-hexadienoic acid sodium salt (CAS: 7757-81-5) safe?

(2E,4E)-2,4-Hexadienoic acid sodium salt (CAS: 7757-81-5) is generally considered safe when used app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...