Compound Q&A

What is 3,5-Dibromo-4-methylbenzoic acid (CAS: 67973-32-4)?

Answer

3,5-Dibromo-4-methylbenzoic acid
3,5-Dibromo-4-methylbenzoic acid, also known as 3,5-Dibromobenzoic acid methyl ester, is a chemical compound with the CAS number 67973-32-4. It has the chemical formula C9H5Br2O2 and is a white crystalline solid. It is soluble in hot water and slightly soluble in cold water. This compound is used in various applications, including pharmaceuticals, as an intermediate in the synthesis of other compounds, and in industrial and research settings.

About

CAS No 67973-32-4
English Name 3,5-Dibromo-4-methylbenzoic acid
Molecular Formula C8H6Br2O2
Molecular Weight 293.94 g/mol
SMILES CC1=C(C=C(C=C1Br)C(=O)O)Br
InChIKey SJCBUASMFSRONS-UHFFFAOYSA-N
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What are the main uses of 3,5-Dibromo-4-methylbenzoic acid (CAS: 67973-32-4)?

3,5-Dibromo-4-methylbenzoic acid is primarily used as an intermediate in the synthesis of other comp...

Compound Q&A

Is 3,5-Dibromo-4-methylbenzoic acid (CAS: 67973-32-4) safe?

3,5-Dibromo-4-methylbenzoic acid (CAS: 67973-32-4) is generally considered safe when handled with ap...

Compound Q&A

How should 3,5-Dibromo-4-methylbenzoic acid (CAS: 67973-32-4) be stored?

3,5-Dibromo-4-methylbenzoic acid should be stored in a cool, dry place away from direct sunlight and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...