Compound Q&A

What is Olanzapine Ketothiolactam (CAS: 1017241-36-9)?

Answer

Olanzapine Ketothiolactam
Olanzapine Ketothiolactam is a chemical compound with the CAS number 1017241-36-9. It is a derivative of olanzapine, a major antipsychotic drug. This compound is typically used in pharmaceutical research and development due to its structural features. Its chemical properties include stability and reactivity, making it relevant for synthetic chemistry studies.

About

English Name Olanzapine Ketothiolactam
Molecular Formula C17H20N4OS
Molecular Weight 328.44 g/mol
SMILES CC(=CC1=C(N=C2C=CC=CC2=NC1=S)N3CCN(CC3)C)O
InChIKey UZXKASHICBLMCC-QBFSEMIESA-N
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What are the main uses of Olanzapine Ketothiolactam (CAS: 1017241-36-9)?

Olanzapine Ketothiolactam (CAS: 1017241-36-9) is primarily used in pharmaceutical research to explor...

Compound Q&A

Is Olanzapine Ketothiolactam (CAS: 1017241-36-9) safe?

Olanzapine Ketothiolactam (CAS: 1017241-36-9) is generally safe when handled with appropriate precau...

Compound Q&A

How should Olanzapine Ketothiolactam (CAS: 1017241-36-9) be stored?

Olanzapine Ketothiolactam (CAS: 1017241-36-9) should be stored in a cool, dry place away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...