Compound Q&A

What are the main uses of [(Diphenylmethyl)sulfinyl]acetic acid (CAS: 63547-24-0)?

Answer

[(Diphenylmethyl)sulfinyl]acetic acid
[(Diphenylmethyl)sulfinyl]acetic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also utilized in research for its unique chemical properties and in some industrial applications for its reactivity and stability. Its specific uses include various chemical synthesis processes and as a reagent in analytical chemistry.

About

CAS No 63547-24-0
English Name [(Diphenylmethyl)sulfinyl]acetic acid
Molecular Formula C15H14O3S
Molecular Weight 274.34 g/mol
SMILES OC(=O)CS(=O)C(c1ccccc1)c2ccccc2
InChIKey QARQPIWTMBRJFX-UHFFFAOYSA-N
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What is [(Diphenylmethyl)sulfinyl]acetic acid (CAS: 63547-24-0)?

[(Diphenylmethyl)sulfinyl]acetic acid is a chemical compound with the CAS number 63547-24-0. It is a...

Compound Q&A

Is [(Diphenylmethyl)sulfinyl]acetic acid (CAS: 63547-24-0) safe?

[(Diphenylmethyl)sulfinyl]acetic acid (CAS: 63547-24-0) is generally safe when handled with appropri...

Compound Q&A

How should [(Diphenylmethyl)sulfinyl]acetic acid (CAS: 63547-24-0) be stored?

[(Diphenylmethyl)sulfinyl]acetic acid (CAS: 63547-24-0) should be stored in a tightly sealed contain...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...