Compound Q&A

How should 4-Fluoro-2-methylbenzenesulfonyl chloride (CAS: 7079-48-3) be stored?

Answer

4-Fluoro-2-methylbenzenesulfonyl chloride
4-Fluoro-2-methylbenzenesulfonyl chloride (CAS: 7079-48-3) should be stored in a cool, dry, well-ventilated area, away from sources of ignition and heat. It should be kept in a tightly sealed container to prevent contamination and degradation. Exposure to light and moisture should be minimized to ensure the stability of the compound.

About

CAS No 7079-48-3
English Name 4-Fluoro-2-methylbenzenesulfonyl chloride
Molecular Formula C7H6ClFO2S
Molecular Weight 208.64 g/mol
SMILES CC1=C(C=CC(=C1)F)S(=O)(=O)Cl
InChIKey XLPGWKNCWMFHOD-UHFFFAOYSA-N
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What is 4-Fluoro-2-methylbenzenesulfonyl chloride (CAS: 7079-48-3)?

4-Fluoro-2-methylbenzenesulfonyl chloride (CAS: 7079-48-3) is a aromatic sulfonic acid derivative us...

Compound Q&A

What are the main uses of 4-Fluoro-2-methylbenzenesulfonyl chloride (CAS: 7079-48-3)?

4-Fluoro-2-methylbenzenesulfonyl chloride (CAS: 7079-48-3) is primarily used in the synthesis of pha...

Compound Q&A

Is 4-Fluoro-2-methylbenzenesulfonyl chloride (CAS: 7079-48-3) safe?

4-Fluoro-2-methylbenzenesulfonyl chloride (CAS: 7079-48-3) can pose certain safety risks. It is flam...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...