Compound Q&A

How should 5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid (CAS: 800401-71-2) be stored?

Answer

5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid
5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. It is recommended to store the compound in a tightly sealed container to prevent degradation and to maintain its stability. It is also important to ensure proper ventilation in the storage area.

About

English Name 5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=C2C=C(NC2=CN=C1Br)C(=O)O
InChIKey NNWNNQTUZYVQRK-UHFFFAOYSA-N
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What is 5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid (CAS: 800401-71-2)?

5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid is a chemical compound with the CAS number 80040...

Compound Q&A

What are the main uses of 5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid (CAS: 800401-71-2)?

5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid is primarily used in pharmaceutical research for...

Compound Q&A

Is 5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid (CAS: 800401-71-2) safe?

Yes, 5-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid is generally considered safe when handled w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...