Compound Q&A

What is (1-Naphthylmethyl)(triphenyl)phosphonium chloride (CAS: 23277-00-1)?

Answer

(1-Naphthylmethyl)(triphenyl)phosphonium chloride
(1-Naphthylmethyl)(triphenyl)phosphonium chloride is an organophosphorus compound with the CAS number 23277-00-1. It consists of a naphthylmethyl phosphonium cation and a chloride anion. This compound is often used in various chemical syntheses and as a Lewis acid in organic reactions due to its unique structure and reactivity.

About

CAS No 23277-00-1
English Name (1-Naphthylmethyl)(triphenyl)phosphonium chloride
Molecular Formula C29H24ClP
Molecular Weight 438.9 g/mol
SMILES C1=CC=C(C=C1)[P+](CC2=CC=CC3=CC=CC=C32)(C4=CC=CC=C4)C5=CC=CC=C5.[Cl-]
InChIKey MOYSMPXSEXYEJV-UHFFFAOYSA-M
Last Updated: 2025-10-24 20:48

Related Q&A

Compound Q&A

What are the main uses of (1-Naphthylmethyl)(triphenyl)phosphonium chloride (CAS: 23277-00-1)?

(1-Naphthylmethyl)(triphenyl)phosphonium chloride is primarily used as a catalyst and Lewis acid in ...

Compound Q&A

Is (1-Naphthylmethyl)(triphenyl)phosphonium chloride (CAS: 23277-00-1) safe?

While (1-Naphthylmethyl)(triphenyl)phosphonium chloride is suitable for its intended applications, i...

Compound Q&A

How should (1-Naphthylmethyl)(triphenyl)phosphonium chloride (CAS: 23277-00-1) be stored?

(1-Naphthylmethyl)(triphenyl)phosphonium chloride should be stored in a cool, dry place, away from d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...