Compound Q&A

How should Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate (CAS: 75203-51-9) be stored?

Answer

Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate
Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate should be stored in a cool, dry place, away from direct sunlight and moisture. It is advisable to keep it in a tightly sealed container and store it at room temperature or below. Avoid exposure to high temperatures and ensure the storage area is well-ventilated to prevent any potential hazards.

About

CAS No 75203-51-9
English Name Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate
Molecular Formula C26H24Cl6O8
Molecular Weight 677.19 g/mol
SMILES CCCCCOC(=O)C1=C(C(=C(C=C1Cl)Cl)Cl)OC(=O)C(=O)OC2=C(C(=CC(=C2Cl)Cl)Cl)C(=O)OCCCCC
InChIKey PURKHUDOTFUVNG-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate (CAS: 75203-51-9)?

Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate is a chemical compound with the CAS numbe...

Compound Q&A

What are the main uses of Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate (CAS: 75203-51-9)?

Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate is primarily used in the pharmaceutical i...

Compound Q&A

Is Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate (CAS: 75203-51-9) safe?

Bis{2,3,5-trichloro-6-[(pentyloxy)carbonyl]phenyl} oxalate is generally considered safe under proper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...