Compound Q&A

How should 2-Bromo-6-nitrobenzoic acid (CAS: 38876-67-4) be stored?

Answer

2-Bromo-6-nitrobenzoic acid
2-Bromo-6-nitrobenzoic acid (CAS: 38876-67-4) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. Store it in a well-ventilated area to ensure proper air circulation and minimize the risk of explosion or decomposition.

About

CAS No 38876-67-4
English Name 2-Bromo-6-nitrobenzoic acid
Molecular Formula C7H4BrNO4
Molecular Weight 246.01 g/mol
SMILES C1=CC(=C(C(=C1)Br)C(=O)O)[N+](=O)[O-]
InChIKey KWNBOCMNFKJJCK-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is 2-Bromo-6-nitrobenzoic acid (CAS: 38876-67-4)?

2-Bromo-6-nitrobenzoic acid (CAS: 38876-67-4) is an organic compound with the molecular formula C7H5...

Compound Q&A

What are the main uses of 2-Bromo-6-nitrobenzoic acid (CAS: 38876-67-4)?

2-Bromo-6-nitrobenzoic acid (CAS: 38876-67-4) is primarily used as a precursor in the synthesis of v...

Compound Q&A

Is 2-Bromo-6-nitrobenzoic acid (CAS: 38876-67-4) safe?

2-Bromo-6-nitrobenzoic acid (CAS: 38876-67-4) is generally safe for handling when appropriate protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...