Compound Q&A

What are the main uses of 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-arabinopyranoside chloride (CAS: 27214-72-8)?

Answer

2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-arabinopyranoside chloride
2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-arabinopyranoside chloride is primarily used in pharmaceutical research for its potential bioactive properties. It may also be utilized in the development of new drugs and in scientific studies for its antioxidant and anti-inflammatory activities.

About

CAS No 27214-72-8
English Name 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-arabinopyranoside chloride
Molecular Formula C20H19ClO10
Molecular Weight 419.36 g/mol
SMILES c1cc(c(cc1c2c(cc3c(cc(cc3[o+]2)O)O)O[C@H]4[C@H]([C@@H]([C@@H](CO4)O)O)O)O)O.[Cl-]
InChIKey ORTBMTXABUAMJS-VGEDXCMYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-arabinopyranoside chloride (CAS: 27214-72-8)?

2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-arabinopyranoside chloride is a complex ...

Compound Q&A

Is 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-arabinopyranoside chloride (CAS: 27214-72-8) safe?

This compound is generally considered safe when handled under appropriate conditions. However, it is...

Compound Q&A

How should 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-chromeniumyl beta-D-arabinopyranoside chloride (CAS: 27214-72-8) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...