Compound Q&A

Is 2-Bromo-4-fluoro-5-nitrobenzoic acid (CAS: 1036389-83-9) safe?

Answer

2-Bromo-4-fluoro-5-nitrobenzoic acid
2-Bromo-4-fluoro-5-nitrobenzoic acid is not considered inherently dangerous, but it requires proper handling due to its reactivity. It is essential to follow safety guidelines, including the use of gloves, goggles, and protective clothing, and to ensure adequate ventilation during use.

About

English Name 2-Bromo-4-fluoro-5-nitrobenzoic acid
Molecular Formula C7H3BrFNO4
Molecular Weight 264.01 g/mol
SMILES C1=C(C(=CC(=C1[N+](=O)[O-])F)Br)C(=O)O
InChIKey APETYHSLTIVOQX-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is 2-Bromo-4-fluoro-5-nitrobenzoic acid (CAS: 1036389-83-9)?

2-Bromo-4-fluoro-5-nitrobenzoic acid is an aromatic carboxylic acid with the molecular formula C7H4B...

Compound Q&A

What are the main uses of 2-Bromo-4-fluoro-5-nitrobenzoic acid (CAS: 1036389-83-9)?

2-Bromo-4-fluoro-5-nitrobenzoic acid is primarily used in the synthesis of pharmaceuticals, dyes, an...

Compound Q&A

How should 2-Bromo-4-fluoro-5-nitrobenzoic acid (CAS: 1036389-83-9) be stored?

2-Bromo-4-fluoro-5-nitrobenzoic acid should be stored in a cool, dry place away from direct sunlight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...