Compound Q&A

What is 1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate (CAS: 83949-75-1)?

Answer

1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate
1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate is a complex organic compound. It is a derivative of indole with a specific substituent pattern. This compound has a molecular structure characterized by a 3-indolium core with a methyl group and a hydrazonate moiety attached. It exhibits properties such as solubility in organic solvents and is typically used in organic synthesis and research.

About

CAS No 83949-75-1
English Name 1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate
Molecular Formula C20H25N3O4S
Molecular Weight 403.5 g/mol
SMILES CC1(C2=CC=CC=C2[N+](=C1C=NN(C)C3=CC=CC=C3)C)C.COS(=O)(=O)[O-]
InChIKey LPQMOFIXRVVOSF-UHFFFAOYSA-M
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What are the main uses of 1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate (CAS: 83949-75-1)?

1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate is primarily used...

Compound Q&A

Is 1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate (CAS: 83949-75-1) safe?

1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate is generally cons...

Compound Q&A

How should 1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate (CAS: 83949-75-1) be stored?

1,3,3-Trimethyl-2-{(E)-[methyl(phenyl)hydrazono]methyl}-3H-indolium methyl sulfate should be stored ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...