Compound Q&A

How should 4-Isoquinolinylboronic acid hydrochloride (CAS: 677702-23-7) be stored?

Answer

4-Isoquinolinylboronic acid hydrochloride (1:1)
4-Isoquinolinylboronic acid hydrochloride (CAS: 677702-23-7) should be stored in a cool, dry place, away from direct sunlight and moisture. It should be kept in a tightly sealed container to prevent moisture absorption. The storage temperature should not exceed 25°C to maintain its stability.

About

English Name 4-Isoquinolinylboronic acid hydrochloride (1:1)
Molecular Formula C9H9BClNO2
Molecular Weight 209.44 g/mol
SMILES B(C1=CN=CC2=CC=CC=C12)(O)O.Cl
InChIKey KVBIOGMRHMKPFZ-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is 4-Isoquinolinylboronic acid hydrochloride (CAS: 677702-23-7)?

4-Isoquinolinylboronic acid hydrochloride (CAS: 677702-23-7) is a chemical compound with the molecul...

Compound Q&A

What are the main uses of 4-Isoquinolinylboronic acid hydrochloride (CAS: 677702-23-7)?

4-Isoquinolinylboronic acid hydrochloride (CAS: 677702-23-7) is primarily used in the synthesis of v...

Compound Q&A

Is 4-Isoquinolinylboronic acid hydrochloride (CAS: 677702-23-7) safe?

4-Isoquinolinylboronic acid hydrochloride (CAS: 677702-23-7) is generally safe when handled with app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...