Compound Q&A

What are the main uses of [7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid (CAS: 80883-54-1)?

Answer

[7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid
7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid is primarily used in pharmaceutical applications, serving as an intermediate in the synthesis of various drugs. It also finds use in research and development for its unique chemical properties, and in certain industrial processes where its reactivity and solubility make it valuable.

About

CAS No 80883-54-1
English Name [7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid
Molecular Formula C13H13NO4
Molecular Weight 247.25 g/mol
SMILES OC(=O)Cc1cc(=O)oc2c1ccc(c2)N(C)C
InChIKey HQMBLJOHUDYJLK-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is [7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid (CAS: 80883-54-1)?

7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid, also known as Chromen-4-carboxylic acid, 7-(dim...

Compound Q&A

Is 7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid (CAS: 80883-54-1) safe?

7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid is generally considered safe when handled with a...

Compound Q&A

How should 7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid (CAS: 80883-54-1) be stored?

7-(Dimethylamino)-2-oxo-2H-chromen-4-yl]acetic acid should be stored in a cool, dry place away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...