Compound Q&A

How should Dipsanoside B (CAS: 889678-64-2) be stored?

Answer

Dipsanoside B
Dipsanoside B (CAS: 889678-64-2) should be stored in a cool, dark, and dry place to minimize degradation. The compound should be kept in a tightly sealed container to prevent moisture and light exposure. Storage at temperatures below 25°C is recommended to maintain its stability.

About

English Name Dipsanoside B
Molecular Formula C66H90O37
Molecular Weight 1475.4 g/mol
SMILES CC1C(CC2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)OC(=O)C4=COC(C(C4CC=C(C=O)C5C(C(OC=C5C(=O)OC6CC7C(C6C)C(OC=C7C(=O)OC)OC8C(C(C(C(O8)CO)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C=C)C=C)OC1C(C(C(C(O1)CO)O)O)O
InChIKey JGFCDHIJCNLFPY-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is Dipsanoside B (CAS: 889678-64-2)?

Dipsanoside B (CAS: 889678-64-2) is a secondary metabolite isolated from Dipsacus asperoides. It is ...

Compound Q&A

What are the main uses of Dipsanoside B (CAS: 889678-64-2)?

Dipsanoside B (CAS: 889678-64-2) is primarily used in pharmaceutical research as a potential therape...

Compound Q&A

Is Dipsanoside B (CAS: 889678-64-2) safe?

Dipsanoside B (CAS: 889678-64-2) is considered safe for research and pharmaceutical applications. Ho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...