Compound Q&A

What is 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (CAS: 437651-44-0)?

Answer

4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (1:1)
4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (CAS: 437651-44-0) is a chemical compound with the structure of a benzoic acid derivative with a dibutylamino propoxy group. It is a white crystalline solid with a pKa of approximately 2.5. This compound is often used in pharmaceuticals for its anti-inflammatory and analgesic properties.

About

English Name 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (1:1)
Molecular Formula C18H30ClNO3
Molecular Weight 343.89 g/mol
SMILES CCCCN(CCCC)CCCOC1=CC=C(C=C1)C(=O)O.Cl
InChIKey HEXBWGNCINCLCP-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What are the main uses of 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (CAS: 437651-44-0)?

4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (CAS: 437651-44-0) is primarily used in the ph...

Compound Q&A

Is 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (CAS: 437651-44-0) safe?

4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (CAS: 437651-44-0) is generally considered saf...

Compound Q&A

How should 4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (CAS: 437651-44-0) be stored?

4-[3-(Dibutylamino)propoxy]benzoic acid hydrochloride (CAS: 437651-44-0) should be stored in a tight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...