Compound Q&A

How should 1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid (CAS: 139756-00-6) be stored?

Answer

1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid
1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid (CAS: 139756-00-6) should be stored in a tightly sealed container to protect it from moisture and light. Store it in a cool, dry place away from heat and direct sunlight to maintain its stability. The optimal storage temperature is below 25°C. Avoid storing it near incompatible materials such as strong acids, bases, and oxidizers.

About

English Name 1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid
Molecular Formula C8H11N3O4
Molecular Weight 213.19 g/mol
SMILES CCCC1=NN(C(=C1[N+](=O)[O-])C(=O)O)C
InChIKey GFORSNBMYCLGIE-UHFFFAOYSA-N
Last Updated: 2025-10-24 11:59

Related Q&A

Compound Q&A

What is 1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid (CAS: 139756-00-6)?

1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid (CAS: 139756-00-6) is a nitrogen-containing ...

Compound Q&A

What are the main uses of 1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid (CAS: 139756-00-6)?

1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid (CAS: 139756-00-6) is primarily used as an i...

Compound Q&A

Is 1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid (CAS: 139756-00-6) safe?

1-Methyl-4-nitro-3-propyl-1H-pyrazole-5-carboxylic acid (CAS: 139756-00-6) is generally considered s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...