Compound Q&A

Are there alternatives to (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate (CAS: 314062-44-7) in synthesis?

Answer

(S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate
While (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate (CAS: 314062-44-7) is a unique compound, there are alternative reagents that can be used in synthesis depending on the desired product. For example, other indole derivatives or amino acids with similar functional groups can serve as alternatives. Isomers and analogs, such as (R)-isomers or related amino acids, might be viable options. However, these alternatives need to be evaluated based on the specific reaction conditions and the desired yield and purity.

About

English Name (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate
Molecular Formula C11H12N2O3.H2O
Molecular Weight 238.24 g/mol
SMILES O=C(O)[C@@H](N)CC1=CNC2=C1C=C(O)C=C2.[H]O[H]
InChIKey UIHHMHBYEZJGNC-FVGYRXGTSA-N
Last Updated: 2025-10-23 17:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate (CAS: 314062-44-7)?

The (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate (CAS: 314062-44-7) falls under var...

Compound Q&A

What is the market or research trend for (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate (CAS: 314062-44-7)?

The market trend for (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate (CAS: 314062-44-7...

Compound Q&A

How should waste containing (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate (CAS: 314062-44-7) be handled?

Waste containing (S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid hydrate (CAS: 314062-44-7) sh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...