Compound Q&A

Are there alternatives to 4-(4-Formyl-3-methoxyphenoxy)butanoic acid in synthesis?

Answer

4-(4-Formyl-3-methoxyphenoxy)butanoic acid
Alternatives to 4-(4-Formyl-3-methoxyphenoxy)butanoic acid in synthesis include similar compounds with varying functional groups, such as other carboxylic acids or esters. Common alternatives include 4-(3-Methoxyphenoxy)butanoic acid or other related formylated derivatives. These can serve as effective substitutes depending on the specific application.

About

English Name 4-(4-Formyl-3-methoxyphenoxy)butanoic acid
Molecular Formula C12H14O5
Molecular Weight 238.24 g/mol
SMILES COC1=C(C=CC(=C1)OCCCC(=O)O)C=O
InChIKey RHQAFYIBBWZTOI-UHFFFAOYSA-N
Last Updated: 2025-10-23 17:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-(4-Formyl-3-methoxyphenoxy)butanoic acid (CAS: 309964-23-6)?

4-(4-Formyl-3-methoxyphenoxy)butanoic acid (CAS: 309964-23-6) is subject to regulatory guidelines su...

Compound Q&A

What is the market or research trend for 4-(4-Formyl-3-methoxyphenoxy)butanoic acid (CAS: 309964-23-6)?

The market and research trends for 4-(4-Formyl-3-methoxyphenoxy)butanoic acid (CAS: 309964-23-6) are...

Compound Q&A

How should waste containing 4-(4-Formyl-3-methoxyphenoxy)butanoic acid (CAS: 309964-23-6) be handled?

Waste containing 4-(4-Formyl-3-methoxyphenoxy)butanoic acid (CAS: 309964-23-6) should be collected i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...