Compound Q&A

Are there alternatives to 2,3-Dihydro-1-benzofuran-5-ylboronic acid in synthesis?

Answer

2,3-Dihydro-1-benzofuran-5-ylboronic acid
Several alternatives to 2,3-Dihydro-1-benzofuran-5-ylboronic acid can be used in synthesis, depending on the specific requirements of the reaction. For example, 2,3-Dihydro-1-benzofuran-5-carbaldehyde can be used as a precursor in some cases, while other boronic acids like phenylboronic acid or 2-methylphenylboronic acid may serve as effective alternatives. The choice of alternative largely depends on the reaction conditions, desired product yield, and the availability of raw materials.

About

English Name 2,3-Dihydro-1-benzofuran-5-ylboronic acid
Molecular Formula C8H9BO3
Molecular Weight 163.97 g/mol
SMILES B(C1=CC2=C(C=C1)OCC2)(O)O
InChIKey ZIXLJHSFAMVHPC-UHFFFAOYSA-N
Last Updated: 2025-10-23 17:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,3-Dihydro-1-benzofuran-5-ylboronic acid (CAS: 227305-69-3)?

2,3-Dihydro-1-benzofuran-5-ylboronic acid (CAS: 227305-69-3) falls under the regulation of the Globa...

Compound Q&A

What is the market or research trend for 2,3-Dihydro-1-benzofuran-5-ylboronic acid (CAS: 227305-69-3)?

The market for 2,3-Dihydro-1-benzofuran-5-ylboronic acid (CAS: 227305-69-3) is steadily growing, dri...

Compound Q&A

How should waste containing 2,3-Dihydro-1-benzofuran-5-ylboronic acid (CAS: 227305-69-3) be handled?

Waste containing 2,3-Dihydro-1-benzofuran-5-ylboronic acid (CAS: 227305-69-3) should be managed acco...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...