Compound Q&A

Are there alternatives to 4-Chloro-3-nitrobenzoyl chloride (CAS: 38818-50-7) in synthesis?

Answer

4-Chloro-3-nitrobenzoyl chloride
Alternatives to 4-Chloro-3-nitrobenzoyl chloride (CAS: 38818-50-7) include other aromatic chlorides and nitriles, such as 4-nitrobenzoyl chloride or 3-chloro-4-nitrobenzoyl chloride. These can be used as substitutes depending on the specific reaction conditions and desired product.

About

CAS No 38818-50-7
English Name 4-Chloro-3-nitrobenzoyl chloride
Molecular Formula C7H3Cl2NO3
Molecular Weight 220.01 g/mol
SMILES C1=CC(=C(C=C1C(=O)Cl)[N+](=O)[O-])Cl
InChIKey IWLGXPWQZDOMSB-UHFFFAOYSA-N
Last Updated: 2025-10-23 17:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-Chloro-3-nitrobenzoyl chloride (CAS: 38818-50-7)?

4-Chloro-3-nitrobenzoyl chloride (CAS: 38818-50-7) is regulated under the Globally Harmonized System...

Compound Q&A

What is the market or research trend for 4-Chloro-3-nitrobenzoyl chloride (CAS: 38818-50-7)?

The market for 4-Chloro-3-nitrobenzoyl chloride (CAS: 38818-50-7) is influenced by its use in organi...

Compound Q&A

How should waste containing 4-Chloro-3-nitrobenzoyl chloride (CAS: 38818-50-7) be handled?

Waste containing 4-Chloro-3-nitrobenzoyl chloride (CAS: 38818-50-7) should be collected in appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...